Oleamide
| Names | |
|---|---|
| Preferred IUPAC name
(9Z)-Octadec-9-enamide | |
| Other names
oleoyl-amide Oleylamide 9-Octadecenamide (Z)-9-Octadecenamide 9,10-Octadecenoamide Oleic acid amide Cis-9,10-octadecenoamide | |
| Identifiers | |
3D model (JSmol) |
|
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| ECHA InfoCard | 100.005.550 |
| EC Number |
|
PubChem CID |
|
| UNII | |
CompTox Dashboard (EPA) |
|
| |
| |
| Properties | |
| C18H35NO | |
| Molar mass | 281.484 g·mol−1 |
| Appearance | Creamy solid |
| Density | 0.879 g/cm3 |
| Melting point | 70 °C (158 °F; 343 K)< |
| Boiling point | > 200 °C (392 °F; 473 K) |
| Insoluble | |
| Hazards | |
| NFPA 704 (fire diamond) | |
| Flash point | > 200 °C (392 °F; 473 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references | |
Oleamide is an organic compound with the formula CH3(CH2)7CH=CH(CH2)7CONH2. It is the amide derived from the fatty acid oleic acid. It is a colorless waxy solid and occurs in nature. Sometimes labeled as a fatty acid primary amide (FAPA), it is biosynthesized from N-oleoylglycine.