Ethyl xanthic acid

Ethyl xanthic acid
Names
	IUPAC name Ethoxymethanedithioic acid
	Other names Carbonodithioic acid, O-ethyl ester; Ethyl xanthic acid; Ethylxanthate; Ethylxanthic acid; Ethylxanthogenic acid; O-Ethyl hydrogen carbonodithioate; O-Ethyl dithiocarbonic acid; Xanthogenic acid;
Identifiers
CAS Number	151-01-9 ;
3D model (JSmol)	Interactive image;
ChEMBL	ChEMBL3039661;
ChemSpider	8492;
EC Number	205-780-8 ;
PubChem CID	8823;
UNII	B7B55M6MK1 ;
	InChI InChI=1S/C3H6OS2/c1-2-4-3(5)6/h2H2,1H3,(H,5,6);
	SMILES CCOC(=S)S;
Properties
Chemical formula	CH3CH2OCS2H
Molar mass	122.20 g·mol−1
Appearance	Colorless oily liquid
Melting point	−53 °C (−63 °F; 220 K)
Boiling point	Decomposes
Solubility in water	Slightly
Acidity (pKa)	1.6
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Ethyl xanthic acid is an organic compound with the chemical formula CH₃CH₂−O−C(=S)−SH. It can be viewed as an O-ethyl ester of dithiocarbonic O,S-acid (the formula of that acid is S=C(OH)(SH)). Ethyl xanthic acid belongs to the category of thioacids, where the prefix thio- means that an oxygen atom in the compound is replaced by a sulfur atom.